C14H12ClFN4 — CID 168591423
2-[[4-(4-chloro-3-fluorophenyl)phenyl]methylideneamino]guanidine (PubChem CID 168591423) has the molecular formula C14H12ClFN4 and a molecular weight of 290.73 g/mol. Its IUPAC name is 2-[[4-(4-chloro-3-fluorophenyl)phenyl]methylideneamino]guanidine.
| Compound Name | 2-[[4-(4-chloro-3-fluorophenyl)phenyl]methylideneamino]guanidine |
|---|---|
| PubChem CID | 168591423 |
| Molecular Formula | C14H12ClFN4 |
| Molecular Weight | 290.73 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | 2-[[4-(4-chloro-3-fluorophenyl)phenyl]methylideneamino]guanidine |
| SMILES | NC(N)=NN=Cc1ccc(-c2ccc(Cl)c(F)c2)cc1 |
| InChI | InChI=1S/C14H12ClFN4/c15-12-6-5-11(7-13(12)16)10-3-1-9(2-4-10)8-19-20-14(17)18/h1-8H,(H4,17,18,20) |
| InChIKey | MPYYUADMPNGEDN-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 76.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.73 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|