C8H7Cl3N4 — CID 140863883
2-[(3,4,5-trichlorophenyl)methylideneamino]guanidine (PubChem CID 140863883) has the molecular formula C8H7Cl3N4 and a molecular weight of 265.53 g/mol. Its IUPAC name is 2-[(3,4,5-trichlorophenyl)methylideneamino]guanidine.
| Compound Name | 2-[(3,4,5-trichlorophenyl)methylideneamino]guanidine |
|---|---|
| PubChem CID | 140863883 |
| Molecular Formula | C8H7Cl3N4 |
| Molecular Weight | 265.53 g/mol |
| Exact Mass | 263.97 |
| IUPAC Name | 2-[(3,4,5-trichlorophenyl)methylideneamino]guanidine |
| SMILES | NC(N)=NN=Cc1cc(Cl)c(Cl)c(Cl)c1 |
| InChI | InChI=1S/C8H7Cl3N4/c9-5-1-4(2-6(10)7(5)11)3-14-15-8(12)13/h1-3H,(H4,12,13,15) |
| InChIKey | DNPBDNDYCVYQTL-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 76.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.53 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|