C10H13BrN8 — CID 140931951
2-[[3-bromo-5-[(diaminomethylidenehydrazinylidene)methyl]phenyl]methylideneamino]guanidine (PubChem CID 140931951) has the molecular formula C10H13BrN8 and a molecular weight of 325.17 g/mol. Its IUPAC name is 2-[[3-bromo-5-[(diaminomethylidenehydrazinylidene)methyl]phenyl]methylideneamino]guanidine.
| Compound Name | 2-[[3-bromo-5-[(diaminomethylidenehydrazinylidene)methyl]phenyl]methylideneamino]guanidine |
|---|---|
| PubChem CID | 140931951 |
| Molecular Formula | C10H13BrN8 |
| Molecular Weight | 325.17 g/mol |
| Exact Mass | 324.04 |
| IUPAC Name | 2-[[3-bromo-5-[(diaminomethylidenehydrazinylidene)methyl]phenyl]methylideneamino]guanidine |
| SMILES | NC(N)=NN=Cc1cc(Br)cc(C=NN=C(N)N)c1 |
| InChI | InChI=1S/C10H13BrN8/c11-8-2-6(4-16-18-9(12)13)1-7(3-8)5-17-19-10(14)15/h1-5H,(H4,12,13,18)(H4,14,15,19) |
| InChIKey | QNANQGXBTGMFHF-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 153.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.17 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|