C10H13BrN4O2 — CID 110538562
2-[(Z)-(5-bromo-2,3-dimethoxyphenyl)methylideneamino]guanidine (PubChem CID 110538562) has the molecular formula C10H13BrN4O2 and a molecular weight of 301.14 g/mol. Its IUPAC name is 2-[(Z)-(5-bromo-2,3-dimethoxyphenyl)methylideneamino]guanidine.
| Compound Name | 2-[(Z)-(5-bromo-2,3-dimethoxyphenyl)methylideneamino]guanidine |
|---|---|
| PubChem CID | 110538562 |
| Molecular Formula | C10H13BrN4O2 |
| Molecular Weight | 301.14 g/mol |
| Exact Mass | 300.02 |
| IUPAC Name | 2-[(Z)-(5-bromo-2,3-dimethoxyphenyl)methylideneamino]guanidine |
| SMILES | COc1cc(Br)cc(/C=N\N=C(N)N)c1OC |
| InChI | InChI=1S/C10H13BrN4O2/c1-16-8-4-7(11)3-6(9(8)17-2)5-14-15-10(12)13/h3-5H,1-2H3,(H4,12,13,15)/b14-5- |
| InChIKey | RCLDGEWGHIXCOK-RZNTYIFUSA-N |
| XLogP | 1.07 |
| TPSA | 95.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.14 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|