C11H16N4O2 — CID 168590500
2-[(2-hydroxy-3-methoxy-4,5-dimethylphenyl)methylideneamino]guanidine (PubChem CID 168590500) has the molecular formula C11H16N4O2 and a molecular weight of 236.28 g/mol. Its IUPAC name is 2-[(2-hydroxy-3-methoxy-4,5-dimethylphenyl)methylideneamino]guanidine.
| Compound Name | 2-[(2-hydroxy-3-methoxy-4,5-dimethylphenyl)methylideneamino]guanidine |
|---|---|
| PubChem CID | 168590500 |
| Molecular Formula | C11H16N4O2 |
| Molecular Weight | 236.28 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | 2-[(2-hydroxy-3-methoxy-4,5-dimethylphenyl)methylideneamino]guanidine |
| SMILES | COc1c(C)c(C)cc(C=NN=C(N)N)c1O |
| InChI | InChI=1S/C11H16N4O2/c1-6-4-8(5-14-15-11(12)13)9(16)10(17-3)7(6)2/h4-5,16H,1-3H3,(H4,12,13,15) |
| InChIKey | DZHCEMCXZOHKSU-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 106.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.28 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|