C9H11BrO2 — CID 84694174
6-bromo-2-methoxy-3,4-dimethylphenol (PubChem CID 84694174) has the molecular formula C9H11BrO2 and a molecular weight of 231.09 g/mol. Its IUPAC name is 6-bromo-2-methoxy-3,4-dimethylphenol.
| Compound Name | 6-bromo-2-methoxy-3,4-dimethylphenol |
|---|---|
| PubChem CID | 84694174 |
| Molecular Formula | C9H11BrO2 |
| Molecular Weight | 231.09 g/mol |
| Exact Mass | 229.99 |
| IUPAC Name | 6-bromo-2-methoxy-3,4-dimethylphenol |
| SMILES | COc1c(C)c(C)cc(Br)c1O |
| InChI | InChI=1S/C9H11BrO2/c1-5-4-7(10)8(11)9(12-3)6(5)2/h4,11H,1-3H3 |
| InChIKey | RRBJVKNOIQEEMO-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.09 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |