C8H8Br2O2 — CID 11822564
2,4-dibromo-3-methoxy-6-methylphenol (PubChem CID 11822564) has the molecular formula C8H8Br2O2 and a molecular weight of 295.96 g/mol. Its IUPAC name is 2,4-dibromo-3-methoxy-6-methylphenol.
| Compound Name | 2,4-dibromo-3-methoxy-6-methylphenol |
|---|---|
| PubChem CID | 11822564 |
| Molecular Formula | C8H8Br2O2 |
| Molecular Weight | 295.96 g/mol |
| Exact Mass | 293.89 |
| IUPAC Name | 2,4-dibromo-3-methoxy-6-methylphenol |
| SMILES | COc1c(Br)cc(C)c(O)c1Br |
| InChI | InChI=1S/C8H8Br2O2/c1-4-3-5(9)8(12-2)6(10)7(4)11/h3,11H,1-2H3 |
| InChIKey | YLSVENZZKYMRCC-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.96 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |