C8H9BrO2 — CID 130032305
2-bromo-4,6-dimethylbenzene-1,3-diol (PubChem CID 130032305) has the molecular formula C8H9BrO2 and a molecular weight of 217.06 g/mol. Its IUPAC name is 2-bromo-4,6-dimethylbenzene-1,3-diol.
| Compound Name | 2-bromo-4,6-dimethylbenzene-1,3-diol |
|---|---|
| PubChem CID | 130032305 |
| Molecular Formula | C8H9BrO2 |
| Molecular Weight | 217.06 g/mol |
| Exact Mass | 215.98 |
| IUPAC Name | 2-bromo-4,6-dimethylbenzene-1,3-diol |
| SMILES | Cc1cc(C)c(O)c(Br)c1O |
| InChI | InChI=1S/C8H9BrO2/c1-4-3-5(2)8(11)6(9)7(4)10/h3,10-11H,1-2H3 |
| InChIKey | XZJUTEICZQGAFC-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.06 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |