C10H14BrNO2 — CID 84806422
4-(3-aminopropyl)-2-bromo-6-methylbenzene-1,3-diol (PubChem CID 84806422) has the molecular formula C10H14BrNO2 and a molecular weight of 260.13 g/mol. Its IUPAC name is 4-(3-aminopropyl)-2-bromo-6-methylbenzene-1,3-diol.
| Compound Name | 4-(3-aminopropyl)-2-bromo-6-methylbenzene-1,3-diol |
|---|---|
| PubChem CID | 84806422 |
| Molecular Formula | C10H14BrNO2 |
| Molecular Weight | 260.13 g/mol |
| Exact Mass | 259.02 |
| IUPAC Name | 4-(3-aminopropyl)-2-bromo-6-methylbenzene-1,3-diol |
| SMILES | Cc1cc(CCCN)c(O)c(Br)c1O |
| InChI | InChI=1S/C10H14BrNO2/c1-6-5-7(3-2-4-12)10(14)8(11)9(6)13/h5,13-14H,2-4,12H2,1H3 |
| InChIKey | ZCYGBSNIOVGRTK-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.13 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |