C12H19Br2NO2 — CID 3031772
4-amino-2-bromo-6-hexylbenzene-1,3-diol;hydrobromide (PubChem CID 3031772) has the molecular formula C12H19Br2NO2 and a molecular weight of 369.10 g/mol. Its IUPAC name is 4-amino-2-bromo-6-hexylbenzene-1,3-diol;hydrobromide.
| Compound Name | 4-amino-2-bromo-6-hexylbenzene-1,3-diol;hydrobromide |
|---|---|
| PubChem CID | 3031772 |
| Molecular Formula | C12H19Br2NO2 |
| Molecular Weight | 369.10 g/mol |
| Exact Mass | 366.98 |
| IUPAC Name | 4-amino-2-bromo-6-hexylbenzene-1,3-diol;hydrobromide |
| SMILES | Br.CCCCCCc1cc(N)c(O)c(Br)c1O |
| InChI | InChI=1S/C12H18BrNO2.BrH/c1-2-3-4-5-6-8-7-9(14)12(16)10(13)11(8)15;/h7,15-16H,2-6,14H2,1H3;1H |
| InChIKey | HKTCKGANOGFHFT-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.10 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|