C7H8BrNO2 — CID 84683345
4-amino-2-bromo-6-methylbenzene-1,3-diol (PubChem CID 84683345) has the molecular formula C7H8BrNO2 and a molecular weight of 218.05 g/mol. Its IUPAC name is 4-amino-2-bromo-6-methylbenzene-1,3-diol.
| Compound Name | 4-amino-2-bromo-6-methylbenzene-1,3-diol |
|---|---|
| PubChem CID | 84683345 |
| Molecular Formula | C7H8BrNO2 |
| Molecular Weight | 218.05 g/mol |
| Exact Mass | 216.97 |
| IUPAC Name | 4-amino-2-bromo-6-methylbenzene-1,3-diol |
| SMILES | Cc1cc(N)c(O)c(Br)c1O |
| InChI | InChI=1S/C7H8BrNO2/c1-3-2-4(9)7(11)5(8)6(3)10/h2,10-11H,9H2,1H3 |
| InChIKey | UCZNLDYJQSMXAY-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.05 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|