C9H13NO3 — CID 84658981
6-amino-2,3-dimethoxy-4-methylphenol (PubChem CID 84658981) has the molecular formula C9H13NO3 and a molecular weight of 183.21 g/mol. Its IUPAC name is 6-amino-2,3-dimethoxy-4-methylphenol.
| Compound Name | 6-amino-2,3-dimethoxy-4-methylphenol |
|---|---|
| PubChem CID | 84658981 |
| Molecular Formula | C9H13NO3 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.09 |
| IUPAC Name | 6-amino-2,3-dimethoxy-4-methylphenol |
| SMILES | COc1c(C)cc(N)c(O)c1OC |
| InChI | InChI=1S/C9H13NO3/c1-5-4-6(10)7(11)9(13-3)8(5)12-2/h4,11H,10H2,1-3H3 |
| InChIKey | FKZMWSOWABMRRZ-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|