C12H17NO2 — CID 84675296
6-amino-2-(cyclopropylmethoxy)-3,4-dimethylphenol (PubChem CID 84675296) has the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. Its IUPAC name is 6-amino-2-(cyclopropylmethoxy)-3,4-dimethylphenol.
| Compound Name | 6-amino-2-(cyclopropylmethoxy)-3,4-dimethylphenol |
|---|---|
| PubChem CID | 84675296 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | 6-amino-2-(cyclopropylmethoxy)-3,4-dimethylphenol |
| SMILES | Cc1cc(N)c(O)c(OCC2CC2)c1C |
| InChI | InChI=1S/C12H17NO2/c1-7-5-10(13)11(14)12(8(7)2)15-6-9-3-4-9/h5,9,14H,3-4,6,13H2,1-2H3 |
| InChIKey | MHSBDSJYQBUAEP-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|