C14H20O2 — CID 117314647
2-[2-(cyclopropylmethoxy)-3,4-dimethylphenyl]ethanol (PubChem CID 117314647) has the molecular formula C14H20O2 and a molecular weight of 220.31 g/mol. Its IUPAC name is 2-[2-(cyclopropylmethoxy)-3,4-dimethylphenyl]ethanol.
| Compound Name | 2-[2-(cyclopropylmethoxy)-3,4-dimethylphenyl]ethanol |
|---|---|
| PubChem CID | 117314647 |
| Molecular Formula | C14H20O2 |
| Molecular Weight | 220.31 g/mol |
| Exact Mass | 220.15 |
| IUPAC Name | 2-[2-(cyclopropylmethoxy)-3,4-dimethylphenyl]ethanol |
| SMILES | Cc1ccc(CCO)c(OCC2CC2)c1C |
| InChI | InChI=1S/C14H20O2/c1-10-3-6-13(7-8-15)14(11(10)2)16-9-12-4-5-12/h3,6,12,15H,4-5,7-9H2,1-2H3 |
| InChIKey | NWDUQCXOCSYIIH-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.31 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |