C15H22NOY+2 — CID 21036652
4-[(2,3,4-trimethylphenoxy)methyl]piperidin-1-ide;yttrium(3+) (PubChem CID 21036652) has the molecular formula C15H22NOY+2 and a molecular weight of 321.25 g/mol. Its IUPAC name is 4-[(2,3,4-trimethylphenoxy)methyl]piperidin-1-ide;yttrium(3+).
| Compound Name | 4-[(2,3,4-trimethylphenoxy)methyl]piperidin-1-ide;yttrium(3+) |
|---|---|
| PubChem CID | 21036652 |
| Molecular Formula | C15H22NOY+2 |
| Molecular Weight | 321.25 g/mol |
| Exact Mass | 321.07 |
| IUPAC Name | 4-[(2,3,4-trimethylphenoxy)methyl]piperidin-1-ide;yttrium(3+) |
| SMILES | Cc1ccc(OCC2CC[N-]CC2)c(C)c1C.[Y+3] |
| InChI | InChI=1S/C15H22NO.Y/c1-11-4-5-15(13(3)12(11)2)17-10-14-6-8-16-9-7-14;/h4-5,14H,6-10H2,1-3H3;/q-1;+3 |
| InChIKey | CZTZZGPNZHRYLB-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 23.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.25 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |