About 2,3-difluoro-1-methyl-4-[(4-methylcyclohexyl)methoxy]benzene;ethane
2,3-difluoro-1-methyl-4-[(4-methylcyclohexyl)methoxy]benzene;ethane (PubChem CID 145011796) has the molecular formula C17H26F2O
and a molecular weight of 284.39 g/mol. Its IUPAC name is 2,3-difluoro-1-methyl-4-[(4-methylcyclohexyl)methoxy]benzene;ethane.
Molecular Properties
| Compound Name | 2,3-difluoro-1-methyl-4-[(4-methylcyclohexyl)methoxy]benzene;ethane |
| PubChem CID | 145011796 |
| Molecular Formula | C17H26F2O |
| Molecular Weight | 284.39 g/mol |
| Exact Mass | 284.20 |
| IUPAC Name | 2,3-difluoro-1-methyl-4-[(4-methylcyclohexyl)methoxy]benzene;ethane |
| SMILES | CC.Cc1ccc(OCC2CCC(C)CC2)c(F)c1F |
| InChI | InChI=1S/C15H20F2O.C2H6/c1-10-3-6-12(7-4-10)9-18-13-8-5-11(2)14(16)15(13)17;1-2/h5,8,10,12H,3-4,6-7,9H2,1-2H3;1-2H3 |
| InChIKey | SKRBIJYVVSYVTO-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 284.39 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,3-difluoro-1-methyl-4-[(4-methylcyclohexyl)methoxy]benzene;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-difluoro-1-methyl-4-[(4-methylcyclohexyl)methoxy]benzene;ethane?
The IUPAC name of 2,3-difluoro-1-methyl-4-[(4-methylcyclohexyl)methoxy]benzene;ethane (CID 145011796) is 2,3-difluoro-1-methyl-4-[(4-methylcyclohexyl)methoxy]benzene;ethane.
What is the SMILES notation for 2,3-difluoro-1-methyl-4-[(4-methylcyclohexyl)methoxy]benzene;ethane?
The canonical SMILES for 2,3-difluoro-1-methyl-4-[(4-methylcyclohexyl)methoxy]benzene;ethane is CC.Cc1ccc(OCC2CCC(C)CC2)c(F)c1F.
What is the InChIKey of 2,3-difluoro-1-methyl-4-[(4-methylcyclohexyl)methoxy]benzene;ethane?
The InChIKey is SKRBIJYVVSYVTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20F2O.C2H6/c1-10-3-6-12(7-4-10)9-18-13-8-5-11(2)14(16)15(13)17;1-2/h5,8,10,12H,3-4,6-7,9H2,1-2H3;1-2H3.
What are the key properties of 2,3-difluoro-1-methyl-4-[(4-methylcyclohexyl)methoxy]benzene;ethane?
2,3-difluoro-1-methyl-4-[(4-methylcyclohexyl)methoxy]benzene;ethane has a molecular weight of 284.39 g/mol, XLogP of 5.50, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-difluoro-1-methyl-4-[(4-methylcyclohexyl)methoxy]benzene;ethane is sourced from PubChem (CID 145011796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).