C13H18O — CID 155323138
1-(cyclopropylmethoxy)-4-ethyl-2-methylbenzene (PubChem CID 155323138) has the molecular formula C13H18O and a molecular weight of 190.29 g/mol. Its IUPAC name is 1-(cyclopropylmethoxy)-4-ethyl-2-methylbenzene.
| Compound Name | 1-(cyclopropylmethoxy)-4-ethyl-2-methylbenzene |
|---|---|
| PubChem CID | 155323138 |
| Molecular Formula | C13H18O |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.14 |
| IUPAC Name | 1-(cyclopropylmethoxy)-4-ethyl-2-methylbenzene |
| SMILES | CCc1ccc(OCC2CC2)c(C)c1 |
| InChI | InChI=1S/C13H18O/c1-3-11-6-7-13(10(2)8-11)14-9-12-4-5-12/h6-8,12H,3-5,9H2,1-2H3 |
| InChIKey | YECYFFPGXVSZRN-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |