C15H18O2 — CID 63214585
4-[4-(cyclopropylmethoxy)-3-methylphenyl]but-3-yn-1-ol (PubChem CID 63214585) has the molecular formula C15H18O2 and a molecular weight of 230.31 g/mol. Its IUPAC name is 4-[4-(cyclopropylmethoxy)-3-methylphenyl]but-3-yn-1-ol.
| Compound Name | 4-[4-(cyclopropylmethoxy)-3-methylphenyl]but-3-yn-1-ol |
|---|---|
| PubChem CID | 63214585 |
| Molecular Formula | C15H18O2 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | 4-[4-(cyclopropylmethoxy)-3-methylphenyl]but-3-yn-1-ol |
| SMILES | Cc1cc(C#CCCO)ccc1OCC1CC1 |
| InChI | InChI=1S/C15H18O2/c1-12-10-13(4-2-3-9-16)7-8-15(12)17-11-14-5-6-14/h7-8,10,14,16H,3,5-6,9,11H2,1H3 |
| InChIKey | XUWJTJQXRFSHAI-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|