C14H15F3O2 — CID 64565315
4-[3-methyl-4-(3,3,3-trifluoropropoxy)phenyl]but-3-yn-1-ol (PubChem CID 64565315) has the molecular formula C14H15F3O2 and a molecular weight of 272.27 g/mol. Its IUPAC name is 4-[3-methyl-4-(3,3,3-trifluoropropoxy)phenyl]but-3-yn-1-ol.
| Compound Name | 4-[3-methyl-4-(3,3,3-trifluoropropoxy)phenyl]but-3-yn-1-ol |
|---|---|
| PubChem CID | 64565315 |
| Molecular Formula | C14H15F3O2 |
| Molecular Weight | 272.27 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | 4-[3-methyl-4-(3,3,3-trifluoropropoxy)phenyl]but-3-yn-1-ol |
| SMILES | Cc1cc(C#CCCO)ccc1OCCC(F)(F)F |
| InChI | InChI=1S/C14H15F3O2/c1-11-10-12(4-2-3-8-18)5-6-13(11)19-9-7-14(15,16)17/h5-6,10,18H,3,7-9H2,1H3 |
| InChIKey | AXVYMNPIYISYTK-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.27 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|