C12H10F4O2 — CID 114675198
3-[4-fluoro-3-(3,3,3-trifluoropropoxy)phenyl]prop-2-yn-1-ol (PubChem CID 114675198) has the molecular formula C12H10F4O2 and a molecular weight of 262.20 g/mol. Its IUPAC name is 3-[4-fluoro-3-(3,3,3-trifluoropropoxy)phenyl]prop-2-yn-1-ol.
| Compound Name | 3-[4-fluoro-3-(3,3,3-trifluoropropoxy)phenyl]prop-2-yn-1-ol |
|---|---|
| PubChem CID | 114675198 |
| Molecular Formula | C12H10F4O2 |
| Molecular Weight | 262.20 g/mol |
| Exact Mass | 262.06 |
| IUPAC Name | 3-[4-fluoro-3-(3,3,3-trifluoropropoxy)phenyl]prop-2-yn-1-ol |
| SMILES | OCC#Cc1ccc(F)c(OCCC(F)(F)F)c1 |
| InChI | InChI=1S/C12H10F4O2/c13-10-4-3-9(2-1-6-17)8-11(10)18-7-5-12(14,15)16/h3-4,8,17H,5-7H2 |
| InChIKey | DBQAELWKCXKEPA-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.20 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|