C15H17F3O3 — CID 63214543
3-[3-methyl-4-[3-(2,2,2-trifluoroethoxy)propoxy]phenyl]prop-2-yn-1-ol (PubChem CID 63214543) has the molecular formula C15H17F3O3 and a molecular weight of 302.29 g/mol. Its IUPAC name is 3-[3-methyl-4-[3-(2,2,2-trifluoroethoxy)propoxy]phenyl]prop-2-yn-1-ol.
| Compound Name | 3-[3-methyl-4-[3-(2,2,2-trifluoroethoxy)propoxy]phenyl]prop-2-yn-1-ol |
|---|---|
| PubChem CID | 63214543 |
| Molecular Formula | C15H17F3O3 |
| Molecular Weight | 302.29 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | 3-[3-methyl-4-[3-(2,2,2-trifluoroethoxy)propoxy]phenyl]prop-2-yn-1-ol |
| SMILES | Cc1cc(C#CCO)ccc1OCCCOCC(F)(F)F |
| InChI | InChI=1S/C15H17F3O3/c1-12-10-13(4-2-7-19)5-6-14(12)21-9-3-8-20-11-15(16,17)18/h5-6,10,19H,3,7-9,11H2,1H3 |
| InChIKey | BSHSFKQFTSVKBL-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.29 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|