C15H16ClF3O2 — CID 63214416
4-(3-chloroprop-1-ynyl)-2-methyl-1-[3-(2,2,2-trifluoroethoxy)propoxy]benzene (PubChem CID 63214416) has the molecular formula C15H16ClF3O2 and a molecular weight of 320.74 g/mol. Its IUPAC name is 4-(3-chloroprop-1-ynyl)-2-methyl-1-[3-(2,2,2-trifluoroethoxy)propoxy]benzene.
| Compound Name | 4-(3-chloroprop-1-ynyl)-2-methyl-1-[3-(2,2,2-trifluoroethoxy)propoxy]benzene |
|---|---|
| PubChem CID | 63214416 |
| Molecular Formula | C15H16ClF3O2 |
| Molecular Weight | 320.74 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | 4-(3-chloroprop-1-ynyl)-2-methyl-1-[3-(2,2,2-trifluoroethoxy)propoxy]benzene |
| SMILES | Cc1cc(C#CCCl)ccc1OCCCOCC(F)(F)F |
| InChI | InChI=1S/C15H16ClF3O2/c1-12-10-13(4-2-7-16)5-6-14(12)21-9-3-8-20-11-15(17,18)19/h5-6,10H,3,7-9,11H2,1H3 |
| InChIKey | MOWLNYDSXYCUJI-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.74 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|