C16H19ClO — CID 63419429
4-(3-chloroprop-1-ynyl)-1-(cyclopentylmethoxy)-2-methylbenzene (PubChem CID 63419429) has the molecular formula C16H19ClO and a molecular weight of 262.78 g/mol. Its IUPAC name is 4-(3-chloroprop-1-ynyl)-1-(cyclopentylmethoxy)-2-methylbenzene.
| Compound Name | 4-(3-chloroprop-1-ynyl)-1-(cyclopentylmethoxy)-2-methylbenzene |
|---|---|
| PubChem CID | 63419429 |
| Molecular Formula | C16H19ClO |
| Molecular Weight | 262.78 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | 4-(3-chloroprop-1-ynyl)-1-(cyclopentylmethoxy)-2-methylbenzene |
| SMILES | Cc1cc(C#CCCl)ccc1OCC1CCCC1 |
| InChI | InChI=1S/C16H19ClO/c1-13-11-14(7-4-10-17)8-9-16(13)18-12-15-5-2-3-6-15/h8-9,11,15H,2-3,5-6,10,12H2,1H3 |
| InChIKey | GGCLYHUMVNONAR-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.78 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|