C14H15ClO — CID 65458621
1-(3-chloroprop-1-ynyl)-3-(cyclobutylmethoxy)benzene (PubChem CID 65458621) has the molecular formula C14H15ClO and a molecular weight of 234.73 g/mol. Its IUPAC name is 1-(3-chloroprop-1-ynyl)-3-(cyclobutylmethoxy)benzene.
| Compound Name | 1-(3-chloroprop-1-ynyl)-3-(cyclobutylmethoxy)benzene |
|---|---|
| PubChem CID | 65458621 |
| Molecular Formula | C14H15ClO |
| Molecular Weight | 234.73 g/mol |
| Exact Mass | 234.08 |
| IUPAC Name | 1-(3-chloroprop-1-ynyl)-3-(cyclobutylmethoxy)benzene |
| SMILES | ClCC#Cc1cccc(OCC2CCC2)c1 |
| InChI | InChI=1S/C14H15ClO/c15-9-3-7-12-4-2-8-14(10-12)16-11-13-5-1-6-13/h2,4,8,10,13H,1,5-6,9,11H2 |
| InChIKey | VLGSSXOMPXCCSU-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.73 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|