C13H15ClO — CID 60799909
1-(3-chloroprop-1-ynyl)-3-(2-methylpropoxy)benzene (PubChem CID 60799909) has the molecular formula C13H15ClO and a molecular weight of 222.72 g/mol. Its IUPAC name is 1-(3-chloroprop-1-ynyl)-3-(2-methylpropoxy)benzene.
| Compound Name | 1-(3-chloroprop-1-ynyl)-3-(2-methylpropoxy)benzene |
|---|---|
| PubChem CID | 60799909 |
| Molecular Formula | C13H15ClO |
| Molecular Weight | 222.72 g/mol |
| Exact Mass | 222.08 |
| IUPAC Name | 1-(3-chloroprop-1-ynyl)-3-(2-methylpropoxy)benzene |
| SMILES | CC(C)COc1cccc(C#CCCl)c1 |
| InChI | InChI=1S/C13H15ClO/c1-11(2)10-15-13-7-3-5-12(9-13)6-4-8-14/h3,5,7,9,11H,8,10H2,1-2H3 |
| InChIKey | IIVAKBKVYBMZSW-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.72 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|