C16H21ClO — CID 63418646
1-(4-chlorobut-1-ynyl)-3-(2-methylpentoxy)benzene (PubChem CID 63418646) has the molecular formula C16H21ClO and a molecular weight of 264.80 g/mol. Its IUPAC name is 1-(4-chlorobut-1-ynyl)-3-(2-methylpentoxy)benzene.
| Compound Name | 1-(4-chlorobut-1-ynyl)-3-(2-methylpentoxy)benzene |
|---|---|
| PubChem CID | 63418646 |
| Molecular Formula | C16H21ClO |
| Molecular Weight | 264.80 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | 1-(4-chlorobut-1-ynyl)-3-(2-methylpentoxy)benzene |
| SMILES | CCCC(C)COc1cccc(C#CCCCl)c1 |
| InChI | InChI=1S/C16H21ClO/c1-3-7-14(2)13-18-16-10-6-9-15(12-16)8-4-5-11-17/h6,9-10,12,14H,3,5,7,11,13H2,1-2H3 |
| InChIKey | NOYSIEBPNJOSPJ-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.80 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|