C22H30O7 — CID 70446708
[2-(carboxyoxymethyl)-5-(3-oct-1-ynylphenoxy)pentyl] hydrogen carbonate (PubChem CID 70446708) has the molecular formula C22H30O7 and a molecular weight of 406.48 g/mol. Its IUPAC name is [2-(carboxyoxymethyl)-5-(3-oct-1-ynylphenoxy)pentyl] hydrogen carbonate.
| Compound Name | [2-(carboxyoxymethyl)-5-(3-oct-1-ynylphenoxy)pentyl] hydrogen carbonate |
|---|---|
| PubChem CID | 70446708 |
| Molecular Formula | C22H30O7 |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.20 |
| IUPAC Name | [2-(carboxyoxymethyl)-5-(3-oct-1-ynylphenoxy)pentyl] hydrogen carbonate |
| SMILES | CCCCCCC#Cc1cccc(OCCCC(COC(=O)O)COC(=O)O)c1 |
| InChI | InChI=1S/C22H30O7/c1-2-3-4-5-6-7-10-18-11-8-13-20(15-18)27-14-9-12-19(16-28-21(23)24)17-29-22(25)26/h8,11,13,15,19H,2-6,9,12,14,16-17H2,1H3,(H,23,24)(H,25,26) |
| InChIKey | XTZQFWSHNKVZED-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|