About butane;oxido-oxo-(3-tridec-1-ynylphenoxy)phosphanium
butane;oxido-oxo-(3-tridec-1-ynylphenoxy)phosphanium (PubChem CID 22420317) has the molecular formula C23H37O3P
and a molecular weight of 392.52 g/mol. Its IUPAC name is butane;oxido-oxo-(3-tridec-1-ynylphenoxy)phosphanium.
Molecular Properties
| Compound Name | butane;oxido-oxo-(3-tridec-1-ynylphenoxy)phosphanium |
| PubChem CID | 22420317 |
| Molecular Formula | C23H37O3P |
| Molecular Weight | 392.52 g/mol |
| Exact Mass | 392.25 |
| IUPAC Name | butane;oxido-oxo-(3-tridec-1-ynylphenoxy)phosphanium |
| SMILES | CCCC.CCCCCCCCCCCC#Cc1cccc(O[P+](=O)[O-])c1 |
| InChI | InChI=1S/C19H27O3P.C4H10/c1-2-3-4-5-6-7-8-9-10-11-12-14-18-15-13-16-19(17-18)22-23(20)21;1-3-4-2/h13,15-17H,2-11H2,1H3;3-4H2,1-2H3 |
| InChIKey | ZDVVBJCDLCKYAI-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 392.52 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze butane;oxido-oxo-(3-tridec-1-ynylphenoxy)phosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane;oxido-oxo-(3-tridec-1-ynylphenoxy)phosphanium?
The IUPAC name of butane;oxido-oxo-(3-tridec-1-ynylphenoxy)phosphanium (CID 22420317) is butane;oxido-oxo-(3-tridec-1-ynylphenoxy)phosphanium.
What is the SMILES notation for butane;oxido-oxo-(3-tridec-1-ynylphenoxy)phosphanium?
The canonical SMILES for butane;oxido-oxo-(3-tridec-1-ynylphenoxy)phosphanium is CCCC.CCCCCCCCCCCC#Cc1cccc(O[P+](=O)[O-])c1.
What is the InChIKey of butane;oxido-oxo-(3-tridec-1-ynylphenoxy)phosphanium?
The InChIKey is ZDVVBJCDLCKYAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H27O3P.C4H10/c1-2-3-4-5-6-7-8-9-10-11-12-14-18-15-13-16-19(17-18)22-23(20)21;1-3-4-2/h13,15-17H,2-11H2,1H3;3-4H2,1-2H3.
What are the key properties of butane;oxido-oxo-(3-tridec-1-ynylphenoxy)phosphanium?
butane;oxido-oxo-(3-tridec-1-ynylphenoxy)phosphanium has a molecular weight of 392.52 g/mol, XLogP of 7.16, 12 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for butane;oxido-oxo-(3-tridec-1-ynylphenoxy)phosphanium is sourced from PubChem (CID 22420317), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).