About 3-hex-1-ynylbenzonitrile
3-hex-1-ynylbenzonitrile (PubChem CID 86099197) has the molecular formula C13H13N
and a molecular weight of 183.25 g/mol. Its IUPAC name is 3-hex-1-ynylbenzonitrile.
Molecular Properties
| Compound Name | 3-hex-1-ynylbenzonitrile |
| PubChem CID | 86099197 |
| Molecular Formula | C13H13N |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.10 |
| IUPAC Name | 3-hex-1-ynylbenzonitrile |
| SMILES | CCCCC#Cc1cccc(C#N)c1 |
| InChI | InChI=1S/C13H13N/c1-2-3-4-5-7-12-8-6-9-13(10-12)11-14/h6,8-10H,2-4H2,1H3 |
| InChIKey | YYTDVXFBCXNTOH-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-hex-1-ynylbenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hex-1-ynylbenzonitrile?
The IUPAC name of 3-hex-1-ynylbenzonitrile (CID 86099197) is 3-hex-1-ynylbenzonitrile.
What is the SMILES notation for 3-hex-1-ynylbenzonitrile?
The canonical SMILES for 3-hex-1-ynylbenzonitrile is CCCCC#Cc1cccc(C#N)c1.
What is the InChIKey of 3-hex-1-ynylbenzonitrile?
The InChIKey is YYTDVXFBCXNTOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13N/c1-2-3-4-5-7-12-8-6-9-13(10-12)11-14/h6,8-10H,2-4H2,1H3.
What are the key properties of 3-hex-1-ynylbenzonitrile?
3-hex-1-ynylbenzonitrile has a molecular weight of 183.25 g/mol, XLogP of 3.10, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hex-1-ynylbenzonitrile is sourced from PubChem (CID 86099197), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).