C21H24N2O3 — CID 59572119
(3,4-diaminophenyl) (3-oct-1-ynylphenyl) carbonate (PubChem CID 59572119) has the molecular formula C21H24N2O3 and a molecular weight of 352.43 g/mol. Its IUPAC name is (3,4-diaminophenyl) (3-oct-1-ynylphenyl) carbonate.
| Compound Name | (3,4-diaminophenyl) (3-oct-1-ynylphenyl) carbonate |
|---|---|
| PubChem CID | 59572119 |
| Molecular Formula | C21H24N2O3 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | (3,4-diaminophenyl) (3-oct-1-ynylphenyl) carbonate |
| SMILES | CCCCCCC#Cc1cccc(OC(=O)Oc2ccc(N)c(N)c2)c1 |
| InChI | InChI=1S/C21H24N2O3/c1-2-3-4-5-6-7-9-16-10-8-11-17(14-16)25-21(24)26-18-12-13-19(22)20(23)15-18/h8,10-15H,2-6,22-23H2,1H3 |
| InChIKey | BSSMIOLFFBQHHQ-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 87.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|