C21H33NO2 — CID 57059061
(2S)-2-amino-1-(3-dodec-1-ynylphenyl)propane-1,3-diol (PubChem CID 57059061) has the molecular formula C21H33NO2 and a molecular weight of 331.50 g/mol. Its IUPAC name is (2S)-2-amino-1-(3-dodec-1-ynylphenyl)propane-1,3-diol.
| Compound Name | (2S)-2-amino-1-(3-dodec-1-ynylphenyl)propane-1,3-diol |
|---|---|
| PubChem CID | 57059061 |
| Molecular Formula | C21H33NO2 |
| Molecular Weight | 331.50 g/mol |
| Exact Mass | 331.25 |
| IUPAC Name | (2S)-2-amino-1-(3-dodec-1-ynylphenyl)propane-1,3-diol |
| SMILES | CCCCCCCCCCC#Cc1cccc(C(O)[C@@H](N)CO)c1 |
| InChI | InChI=1S/C21H33NO2/c1-2-3-4-5-6-7-8-9-10-11-13-18-14-12-15-19(16-18)21(24)20(22)17-23/h12,14-16,20-21,23-24H,2-10,17,22H2,1H3/t20-,21?/m0/s1 |
| InChIKey | AZCHDJYMUOCTQH-BGERDNNASA-N |
| XLogP | 3.92 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.50 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|