C17H23NO2 — CID 59260246
3-hept-1-ynyl-N-(1-hydroxypropan-2-yl)benzamide (PubChem CID 59260246) has the molecular formula C17H23NO2 and a molecular weight of 273.38 g/mol. Its IUPAC name is 3-hept-1-ynyl-N-(1-hydroxypropan-2-yl)benzamide.
| Compound Name | 3-hept-1-ynyl-N-(1-hydroxypropan-2-yl)benzamide |
|---|---|
| PubChem CID | 59260246 |
| Molecular Formula | C17H23NO2 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | 3-hept-1-ynyl-N-(1-hydroxypropan-2-yl)benzamide |
| SMILES | CCCCCC#Cc1cccc(C(=O)NC(C)CO)c1 |
| InChI | InChI=1S/C17H23NO2/c1-3-4-5-6-7-9-15-10-8-11-16(12-15)17(20)18-14(2)13-19/h8,10-12,14,19H,3-6,13H2,1-2H3,(H,18,20) |
| InChIKey | LVNBMVWGKOVFOZ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|