C22H33NO3 — CID 18373000
N-[1,3-dihydroxy-1-(3-undec-1-ynylphenyl)propan-2-yl]acetamide (PubChem CID 18373000) has the molecular formula C22H33NO3 and a molecular weight of 359.51 g/mol. Its IUPAC name is N-[1,3-dihydroxy-1-(3-undec-1-ynylphenyl)propan-2-yl]acetamide.
| Compound Name | N-[1,3-dihydroxy-1-(3-undec-1-ynylphenyl)propan-2-yl]acetamide |
|---|---|
| PubChem CID | 18373000 |
| Molecular Formula | C22H33NO3 |
| Molecular Weight | 359.51 g/mol |
| Exact Mass | 359.25 |
| IUPAC Name | N-[1,3-dihydroxy-1-(3-undec-1-ynylphenyl)propan-2-yl]acetamide |
| SMILES | CCCCCCCCCC#Cc1cccc(C(O)C(CO)NC(C)=O)c1 |
| InChI | InChI=1S/C22H33NO3/c1-3-4-5-6-7-8-9-10-11-13-19-14-12-15-20(16-19)22(26)21(17-24)23-18(2)25/h12,14-16,21-22,24,26H,3-10,17H2,1-2H3,(H,23,25) |
| InChIKey | RPVOMEIXGZJZGB-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.51 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|