C23H24N2O3 — CID 68887959
N-[(2R)-1-hydroxy-2-(1H-indol-3-yl)propyl]-3-(5-hydroxypent-1-ynyl)benzamide (PubChem CID 68887959) has the molecular formula C23H24N2O3 and a molecular weight of 376.46 g/mol. Its IUPAC name is N-[(2R)-1-hydroxy-2-(1H-indol-3-yl)propyl]-3-(5-hydroxypent-1-ynyl)benzamide.
| Compound Name | N-[(2R)-1-hydroxy-2-(1H-indol-3-yl)propyl]-3-(5-hydroxypent-1-ynyl)benzamide |
|---|---|
| PubChem CID | 68887959 |
| Molecular Formula | C23H24N2O3 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | N-[(2R)-1-hydroxy-2-(1H-indol-3-yl)propyl]-3-(5-hydroxypent-1-ynyl)benzamide |
| SMILES | C[C@H](c1c[nH]c2ccccc12)C(O)NC(=O)c1cccc(C#CCCCO)c1 |
| InChI | InChI=1S/C23H24N2O3/c1-16(20-15-24-21-12-5-4-11-19(20)21)22(27)25-23(28)18-10-7-9-17(14-18)8-3-2-6-13-26/h4-5,7,9-12,14-16,22,24,26-27H,2,6,13H2,1H3,(H,25,28)/t16-,22?/m1/s1 |
| InChIKey | GDIGWHLTRKXRFU-XESZBRCGSA-N |
| XLogP | 3.14 |
| TPSA | 85.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|