C25H26N2O4 — CID 68883726
methyl 6-[3-[[(1R)-1-hydroxy-2-(1H-indol-3-yl)ethyl]-methylcarbamoyl]phenyl]hex-5-ynoate (PubChem CID 68883726) has the molecular formula C25H26N2O4 and a molecular weight of 418.49 g/mol. Its IUPAC name is methyl 6-[3-[[(1R)-1-hydroxy-2-(1H-indol-3-yl)ethyl]-methylcarbamoyl]phenyl]hex-5-ynoate.
| Compound Name | methyl 6-[3-[[(1R)-1-hydroxy-2-(1H-indol-3-yl)ethyl]-methylcarbamoyl]phenyl]hex-5-ynoate |
|---|---|
| PubChem CID | 68883726 |
| Molecular Formula | C25H26N2O4 |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | methyl 6-[3-[[(1R)-1-hydroxy-2-(1H-indol-3-yl)ethyl]-methylcarbamoyl]phenyl]hex-5-ynoate |
| SMILES | COC(=O)CCCC#Cc1cccc(C(=O)N(C)[C@H](O)Cc2c[nH]c3ccccc23)c1 |
| InChI | InChI=1S/C25H26N2O4/c1-27(23(28)16-20-17-26-22-13-7-6-12-21(20)22)25(30)19-11-8-10-18(15-19)9-4-3-5-14-24(29)31-2/h6-8,10-13,15,17,23,26,28H,3,5,14,16H2,1-2H3/t23-/m1/s1 |
| InChIKey | WEKJVAAETPQIPF-HSZRJFAPSA-N |
| XLogP | 3.50 |
| TPSA | 82.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|