C27H30N2O4 — CID 25207554
9-[3-[[(2R)-1-hydroxy-3-(1H-indol-3-yl)propan-2-yl]carbamoyl]phenyl]non-8-ynoic acid (PubChem CID 25207554) has the molecular formula C27H30N2O4 and a molecular weight of 446.55 g/mol. Its IUPAC name is 9-[3-[[(2R)-1-hydroxy-3-(1H-indol-3-yl)propan-2-yl]carbamoyl]phenyl]non-8-ynoic acid.
| Compound Name | 9-[3-[[(2R)-1-hydroxy-3-(1H-indol-3-yl)propan-2-yl]carbamoyl]phenyl]non-8-ynoic acid |
|---|---|
| PubChem CID | 25207554 |
| Molecular Formula | C27H30N2O4 |
| Molecular Weight | 446.55 g/mol |
| Exact Mass | 446.22 |
| IUPAC Name | 9-[3-[[(2R)-1-hydroxy-3-(1H-indol-3-yl)propan-2-yl]carbamoyl]phenyl]non-8-ynoic acid |
| SMILES | O=C(O)CCCCCCC#Cc1cccc(C(=O)N[C@@H](CO)Cc2c[nH]c3ccccc23)c1 |
| InChI | InChI=1S/C27H30N2O4/c30-19-23(17-22-18-28-25-14-8-7-13-24(22)25)29-27(33)21-12-9-11-20(16-21)10-5-3-1-2-4-6-15-26(31)32/h7-9,11-14,16,18,23,28,30H,1-4,6,15,17,19H2,(H,29,33)(H,31,32)/t23-/m1/s1 |
| InChIKey | DSZKYFALBLLDRH-HSZRJFAPSA-N |
| XLogP | 4.28 |
| TPSA | 102.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.55 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|