C34H33N3O6 — CID 58831981
6-(4-hydroxybut-1-ynyl)-N-[(2R)-1-hydroxy-3-(1H-indol-3-yl)propan-2-yl]-2-(3,4,5-trimethoxyphenyl)quinoline-4-carboxamide (PubChem CID 58831981) has the molecular formula C34H33N3O6 and a molecular weight of 579.65 g/mol. Its IUPAC name is 6-(4-hydroxybut-1-ynyl)-N-[(2R)-1-hydroxy-3-(1H-indol-3-yl)propan-2-yl]-2-(3,4,5-trimethoxyphenyl)quinoline-4-carboxamide.
| Compound Name | 6-(4-hydroxybut-1-ynyl)-N-[(2R)-1-hydroxy-3-(1H-indol-3-yl)propan-2-yl]-2-(3,4,5-trimethoxyphenyl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 58831981 |
| Molecular Formula | C34H33N3O6 |
| Molecular Weight | 579.65 g/mol |
| Exact Mass | 579.24 |
| IUPAC Name | 6-(4-hydroxybut-1-ynyl)-N-[(2R)-1-hydroxy-3-(1H-indol-3-yl)propan-2-yl]-2-(3,4,5-trimethoxyphenyl)quinoline-4-carboxamide |
| SMILES | COc1cc(-c2cc(C(=O)N[C@@H](CO)Cc3c[nH]c4ccccc34)c3cc(C#CCCO)ccc3n2)cc(OC)c1OC |
| InChI | InChI=1S/C34H33N3O6/c1-41-31-16-22(17-32(42-2)33(31)43-3)30-18-27(26-14-21(8-6-7-13-38)11-12-29(26)37-30)34(40)36-24(20-39)15-23-19-35-28-10-5-4-9-25(23)28/h4-5,9-12,14,16-19,24,35,38-39H,7,13,15,20H2,1-3H3,(H,36,40)/t24-/m1/s1 |
| InChIKey | ZDZONSIVUHZSKM-XMMPIXPASA-N |
| XLogP | 4.48 |
| TPSA | 125.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.65 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|