C30H25N3O3 — CID 25127742
N-[(2R)-1-hydroxy-3-(1H-indol-3-yl)propan-2-yl]-6-[2-(2-methoxyphenyl)ethynyl]quinoline-8-carboxamide (PubChem CID 25127742) has the molecular formula C30H25N3O3 and a molecular weight of 475.55 g/mol. Its IUPAC name is N-[(2R)-1-hydroxy-3-(1H-indol-3-yl)propan-2-yl]-6-[2-(2-methoxyphenyl)ethynyl]quinoline-8-carboxamide.
| Compound Name | N-[(2R)-1-hydroxy-3-(1H-indol-3-yl)propan-2-yl]-6-[2-(2-methoxyphenyl)ethynyl]quinoline-8-carboxamide |
|---|---|
| PubChem CID | 25127742 |
| Molecular Formula | C30H25N3O3 |
| Molecular Weight | 475.55 g/mol |
| Exact Mass | 475.19 |
| IUPAC Name | N-[(2R)-1-hydroxy-3-(1H-indol-3-yl)propan-2-yl]-6-[2-(2-methoxyphenyl)ethynyl]quinoline-8-carboxamide |
| SMILES | COc1ccccc1C#Cc1cc(C(=O)N[C@@H](CO)Cc2c[nH]c3ccccc23)c2ncccc2c1 |
| InChI | InChI=1S/C30H25N3O3/c1-36-28-11-5-2-7-21(28)13-12-20-15-22-8-6-14-31-29(22)26(16-20)30(35)33-24(19-34)17-23-18-32-27-10-4-3-9-25(23)27/h2-11,14-16,18,24,32,34H,17,19H2,1H3,(H,33,35)/t24-/m1/s1 |
| InChIKey | BOWARNINZJIWTO-XMMPIXPASA-N |
| XLogP | 4.46 |
| TPSA | 87.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.55 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|