C30H26N2O4 — CID 24959109
N-[(2R)-1-hydroxy-3-(1H-indol-3-yl)propan-2-yl]-6-[2-(2-methoxyphenyl)ethynyl]-2H-chromene-8-carboxamide (PubChem CID 24959109) has the molecular formula C30H26N2O4 and a molecular weight of 478.55 g/mol. Its IUPAC name is N-[(2R)-1-hydroxy-3-(1H-indol-3-yl)propan-2-yl]-6-[2-(2-methoxyphenyl)ethynyl]-2H-chromene-8-carboxamide.
| Compound Name | N-[(2R)-1-hydroxy-3-(1H-indol-3-yl)propan-2-yl]-6-[2-(2-methoxyphenyl)ethynyl]-2H-chromene-8-carboxamide |
|---|---|
| PubChem CID | 24959109 |
| Molecular Formula | C30H26N2O4 |
| Molecular Weight | 478.55 g/mol |
| Exact Mass | 478.19 |
| IUPAC Name | N-[(2R)-1-hydroxy-3-(1H-indol-3-yl)propan-2-yl]-6-[2-(2-methoxyphenyl)ethynyl]-2H-chromene-8-carboxamide |
| SMILES | COc1ccccc1C#Cc1cc2c(c(C(=O)N[C@@H](CO)Cc3c[nH]c4ccccc34)c1)OCC=C2 |
| InChI | InChI=1S/C30H26N2O4/c1-35-28-11-5-2-7-21(28)13-12-20-15-22-8-6-14-36-29(22)26(16-20)30(34)32-24(19-33)17-23-18-31-27-10-4-3-9-25(23)27/h2-11,15-16,18,24,31,33H,14,17,19H2,1H3,(H,32,34)/t24-/m1/s1 |
| InChIKey | NOGGRKIJXISCDN-XMMPIXPASA-N |
| XLogP | 4.32 |
| TPSA | 83.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.55 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|