C22H19NO6 — CID 69111128
6-(3-hydroxyprop-1-ynyl)-2-(3,4,5-trimethoxyphenyl)quinoline-4-carboxylic acid (PubChem CID 69111128) has the molecular formula C22H19NO6 and a molecular weight of 393.40 g/mol. Its IUPAC name is 6-(3-hydroxyprop-1-ynyl)-2-(3,4,5-trimethoxyphenyl)quinoline-4-carboxylic acid.
| Compound Name | 6-(3-hydroxyprop-1-ynyl)-2-(3,4,5-trimethoxyphenyl)quinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 69111128 |
| Molecular Formula | C22H19NO6 |
| Molecular Weight | 393.40 g/mol |
| Exact Mass | 393.12 |
| IUPAC Name | 6-(3-hydroxyprop-1-ynyl)-2-(3,4,5-trimethoxyphenyl)quinoline-4-carboxylic acid |
| SMILES | COc1cc(-c2cc(C(=O)O)c3cc(C#CCO)ccc3n2)cc(OC)c1OC |
| InChI | InChI=1S/C22H19NO6/c1-27-19-10-14(11-20(28-2)21(19)29-3)18-12-16(22(25)26)15-9-13(5-4-8-24)6-7-17(15)23-18/h6-7,9-12,24H,8H2,1-3H3,(H,25,26) |
| InChIKey | BLZFBZKRZOZTJI-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 98.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.40 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|