C16H13NO4S — CID 18073660
6,7-dimethoxy-2-thiophen-3-ylquinoline-4-carboxylic acid (PubChem CID 18073660) has the molecular formula C16H13NO4S and a molecular weight of 315.35 g/mol. Its IUPAC name is 6,7-dimethoxy-2-thiophen-3-ylquinoline-4-carboxylic acid.
| Compound Name | 6,7-dimethoxy-2-thiophen-3-ylquinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 18073660 |
| Molecular Formula | C16H13NO4S |
| Molecular Weight | 315.35 g/mol |
| Exact Mass | 315.06 |
| IUPAC Name | 6,7-dimethoxy-2-thiophen-3-ylquinoline-4-carboxylic acid |
| SMILES | COc1cc2nc(-c3ccsc3)cc(C(=O)O)c2cc1OC |
| InChI | InChI=1S/C16H13NO4S/c1-20-14-6-10-11(16(18)19)5-12(9-3-4-22-8-9)17-13(10)7-15(14)21-2/h3-8H,1-2H3,(H,18,19) |
| InChIKey | RVTBCWWISMRTLK-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.35 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |