5,7-difluoro-2-thiophen-3-ylquinoline-4-carboxylic acid

C14H7F2NO2S — CID 62090461

IUPAC5,7-difluoro-2-thiophen-3-ylquinoline-4-carboxylic acid
SMILESO=C(O)c1cc(-c2ccsc2)nc2cc(F)cc(F)c12
InChIInChI=1S/C14H7F2NO2S/c15-8-3-10(16)13-9(14(18)19)5-11(17-12(13)4-8)7-1-2-20-6-7/h1-6H,(H,18,19)
InChIKeyNCMFERQWMFENGQ-UHFFFAOYSA-N
MW291.28 g/mol
LogP3.94
Rot. Bonds2

About 5,7-difluoro-2-thiophen-3-ylquinoline-4-carboxylic acid

5,7-difluoro-2-thiophen-3-ylquinoline-4-carboxylic acid (PubChem CID 62090461) has the molecular formula C14H7F2NO2S and a molecular weight of 291.28 g/mol. Its IUPAC name is 5,7-difluoro-2-thiophen-3-ylquinoline-4-carboxylic acid.

Molecular Properties

Compound Name5,7-difluoro-2-thiophen-3-ylquinoline-4-carboxylic acid
PubChem CID62090461
Molecular FormulaC14H7F2NO2S
Molecular Weight291.28 g/mol
Exact Mass291.02
IUPAC Name5,7-difluoro-2-thiophen-3-ylquinoline-4-carboxylic acid
SMILESO=C(O)c1cc(-c2ccsc2)nc2cc(F)cc(F)c12
InChIInChI=1S/C14H7F2NO2S/c15-8-3-10(16)13-9(14(18)19)5-11(17-12(13)4-8)7-1-2-20-6-7/h1-6H,(H,18,19)
InChIKeyNCMFERQWMFENGQ-UHFFFAOYSA-N
XLogP3.94
TPSA50.19 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500291.28
LogP ≤ 53.94
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 5,7-difluoro-2-thiophen-3-ylquinoline-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5,7-difluoro-2-thiophen-3-ylquinoline-4-carboxylic acid?
The IUPAC name of 5,7-difluoro-2-thiophen-3-ylquinoline-4-carboxylic acid (CID 62090461) is 5,7-difluoro-2-thiophen-3-ylquinoline-4-carboxylic acid.
What is the SMILES notation for 5,7-difluoro-2-thiophen-3-ylquinoline-4-carboxylic acid?
The canonical SMILES for 5,7-difluoro-2-thiophen-3-ylquinoline-4-carboxylic acid is O=C(O)c1cc(-c2ccsc2)nc2cc(F)cc(F)c12.
What is the InChIKey of 5,7-difluoro-2-thiophen-3-ylquinoline-4-carboxylic acid?
The InChIKey is NCMFERQWMFENGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H7F2NO2S/c15-8-3-10(16)13-9(14(18)19)5-11(17-12(13)4-8)7-1-2-20-6-7/h1-6H,(H,18,19).
What are the key properties of 5,7-difluoro-2-thiophen-3-ylquinoline-4-carboxylic acid?
5,7-difluoro-2-thiophen-3-ylquinoline-4-carboxylic acid has a molecular weight of 291.28 g/mol, XLogP of 3.94, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5,7-difluoro-2-thiophen-3-ylquinoline-4-carboxylic acid is sourced from PubChem (CID 62090461), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).