C14H7F2NO2S — CID 80746977
6,7-difluoro-2-thiophen-3-ylquinoline-4-carboxylic acid (PubChem CID 80746977) has the molecular formula C14H7F2NO2S and a molecular weight of 291.28 g/mol. Its IUPAC name is 6,7-difluoro-2-thiophen-3-ylquinoline-4-carboxylic acid.
| Compound Name | 6,7-difluoro-2-thiophen-3-ylquinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 80746977 |
| Molecular Formula | C14H7F2NO2S |
| Molecular Weight | 291.28 g/mol |
| Exact Mass | 291.02 |
| IUPAC Name | 6,7-difluoro-2-thiophen-3-ylquinoline-4-carboxylic acid |
| SMILES | O=C(O)c1cc(-c2ccsc2)nc2cc(F)c(F)cc12 |
| InChI | InChI=1S/C14H7F2NO2S/c15-10-3-8-9(14(18)19)4-12(7-1-2-20-6-7)17-13(8)5-11(10)16/h1-6H,(H,18,19) |
| InChIKey | JBNPNXKKMBJUIT-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.28 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |