C12H6F2N2OS — CID 163404502
6,7-difluoro-2-thiophen-3-yl-3H-quinazolin-4-one (PubChem CID 163404502) has the molecular formula C12H6F2N2OS and a molecular weight of 264.26 g/mol. Its IUPAC name is 6,7-difluoro-2-thiophen-3-yl-3H-quinazolin-4-one.
| Compound Name | 6,7-difluoro-2-thiophen-3-yl-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 163404502 |
| Molecular Formula | C12H6F2N2OS |
| Molecular Weight | 264.26 g/mol |
| Exact Mass | 264.02 |
| IUPAC Name | 6,7-difluoro-2-thiophen-3-yl-3H-quinazolin-4-one |
| SMILES | O=c1[nH]c(-c2ccsc2)nc2cc(F)c(F)cc12 |
| InChI | InChI=1S/C12H6F2N2OS/c13-8-3-7-10(4-9(8)14)15-11(16-12(7)17)6-1-2-18-5-6/h1-5H,(H,15,16,17) |
| InChIKey | YGDMYXDCCNFCKT-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.26 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |