C14H10N2O3 — CID 137014833
6,7-dihydroxy-2-phenyl-3H-quinazolin-4-one (PubChem CID 137014833) has the molecular formula C14H10N2O3 and a molecular weight of 254.25 g/mol. Its IUPAC name is 6,7-dihydroxy-2-phenyl-3H-quinazolin-4-one.
| Compound Name | 6,7-dihydroxy-2-phenyl-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 137014833 |
| Molecular Formula | C14H10N2O3 |
| Molecular Weight | 254.25 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | 6,7-dihydroxy-2-phenyl-3H-quinazolin-4-one |
| SMILES | O=c1[nH]c(-c2ccccc2)nc2cc(O)c(O)cc12 |
| InChI | InChI=1S/C14H10N2O3/c17-11-6-9-10(7-12(11)18)15-13(16-14(9)19)8-4-2-1-3-5-8/h1-7,17-18H,(H,15,16,19) |
| InChIKey | IRGMMWIKVYTHAW-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 86.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.25 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|