C14H10N2O4 — CID 135999629
2-(3,5-dihydroxyphenyl)-6-hydroxy-3H-quinazolin-4-one (PubChem CID 135999629) has the molecular formula C14H10N2O4 and a molecular weight of 270.24 g/mol. Its IUPAC name is 2-(3,5-dihydroxyphenyl)-6-hydroxy-3H-quinazolin-4-one.
| Compound Name | 2-(3,5-dihydroxyphenyl)-6-hydroxy-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 135999629 |
| Molecular Formula | C14H10N2O4 |
| Molecular Weight | 270.24 g/mol |
| Exact Mass | 270.06 |
| IUPAC Name | 2-(3,5-dihydroxyphenyl)-6-hydroxy-3H-quinazolin-4-one |
| SMILES | O=c1[nH]c(-c2cc(O)cc(O)c2)nc2ccc(O)cc12 |
| InChI | InChI=1S/C14H10N2O4/c17-8-1-2-12-11(6-8)14(20)16-13(15-12)7-3-9(18)5-10(19)4-7/h1-6,17-19H,(H,15,16,20) |
| InChIKey | XUOJPKZACZZZOI-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 106.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.24 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |