C10H7N3O2 — CID 137182260
2-(6-hydroxy-4-oxo-3H-quinazolin-2-yl)acetonitrile (PubChem CID 137182260) has the molecular formula C10H7N3O2 and a molecular weight of 201.18 g/mol. Its IUPAC name is 2-(6-hydroxy-4-oxo-3H-quinazolin-2-yl)acetonitrile.
| Compound Name | 2-(6-hydroxy-4-oxo-3H-quinazolin-2-yl)acetonitrile |
|---|---|
| PubChem CID | 137182260 |
| Molecular Formula | C10H7N3O2 |
| Molecular Weight | 201.18 g/mol |
| Exact Mass | 201.05 |
| IUPAC Name | 2-(6-hydroxy-4-oxo-3H-quinazolin-2-yl)acetonitrile |
| SMILES | N#CCc1nc2ccc(O)cc2c(=O)[nH]1 |
| InChI | InChI=1S/C10H7N3O2/c11-4-3-9-12-8-2-1-6(14)5-7(8)10(15)13-9/h1-2,5,14H,3H2,(H,12,13,15) |
| InChIKey | VGXSNJUJVLNWIS-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 89.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.18 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |