C10H10FN2O4P — CID 135653898
(6-fluoro-4-oxo-3H-quinazolin-2-yl)methyl-(hydroxymethyl)phosphinic acid (PubChem CID 135653898) has the molecular formula C10H10FN2O4P and a molecular weight of 272.17 g/mol. Its IUPAC name is (6-fluoro-4-oxo-3H-quinazolin-2-yl)methyl-(hydroxymethyl)phosphinic acid.
| Compound Name | (6-fluoro-4-oxo-3H-quinazolin-2-yl)methyl-(hydroxymethyl)phosphinic acid |
|---|---|
| PubChem CID | 135653898 |
| Molecular Formula | C10H10FN2O4P |
| Molecular Weight | 272.17 g/mol |
| Exact Mass | 272.04 |
| IUPAC Name | (6-fluoro-4-oxo-3H-quinazolin-2-yl)methyl-(hydroxymethyl)phosphinic acid |
| SMILES | O=c1[nH]c(CP(=O)(O)CO)nc2ccc(F)cc12 |
| InChI | InChI=1S/C10H10FN2O4P/c11-6-1-2-8-7(3-6)10(15)13-9(12-8)4-18(16,17)5-14/h1-3,14H,4-5H2,(H,16,17)(H,12,13,15) |
| InChIKey | CRXMVTPOSKSKHW-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 103.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.17 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|