C17H14ClF2N3O3 — CID 159028152
2-(chloromethyl)-6-fluoro-3H-quinazolin-4-one;methyl 2-amino-5-fluorobenzoate (PubChem CID 159028152) has the molecular formula C17H14ClF2N3O3 and a molecular weight of 381.77 g/mol. Its IUPAC name is 2-(chloromethyl)-6-fluoro-3H-quinazolin-4-one;methyl 2-amino-5-fluorobenzoate.
| Compound Name | 2-(chloromethyl)-6-fluoro-3H-quinazolin-4-one;methyl 2-amino-5-fluorobenzoate |
|---|---|
| PubChem CID | 159028152 |
| Molecular Formula | C17H14ClF2N3O3 |
| Molecular Weight | 381.77 g/mol |
| Exact Mass | 381.07 |
| IUPAC Name | 2-(chloromethyl)-6-fluoro-3H-quinazolin-4-one;methyl 2-amino-5-fluorobenzoate |
| SMILES | COC(=O)c1cc(F)ccc1N.O=c1[nH]c(CCl)nc2ccc(F)cc12 |
| InChI | InChI=1S/C9H6ClFN2O.C8H8FNO2/c10-4-8-12-7-2-1-5(11)3-6(7)9(14)13-8;1-12-8(11)6-4-5(9)2-3-7(6)10/h1-3H,4H2,(H,12,13,14);2-4H,10H2,1H3 |
| InChIKey | JUNPHSALQJHRTK-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 98.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.77 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|