C12H8Cl2N4O2 — CID 135437105
2,7-bis(chloromethyl)-3,8-dihydropyrimido[4,5-g]quinazoline-4,9-dione (PubChem CID 135437105) has the molecular formula C12H8Cl2N4O2 and a molecular weight of 311.13 g/mol. Its IUPAC name is 2,7-bis(chloromethyl)-3,8-dihydropyrimido[4,5-g]quinazoline-4,9-dione.
| Compound Name | 2,7-bis(chloromethyl)-3,8-dihydropyrimido[4,5-g]quinazoline-4,9-dione |
|---|---|
| PubChem CID | 135437105 |
| Molecular Formula | C12H8Cl2N4O2 |
| Molecular Weight | 311.13 g/mol |
| Exact Mass | 310.00 |
| IUPAC Name | 2,7-bis(chloromethyl)-3,8-dihydropyrimido[4,5-g]quinazoline-4,9-dione |
| SMILES | O=c1[nH]c(CCl)nc2cc3c(=O)[nH]c(CCl)nc3cc12 |
| InChI | InChI=1S/C12H8Cl2N4O2/c13-3-9-15-7-1-5-8(2-6(7)12(20)18-9)16-10(4-14)17-11(5)19/h1-2H,3-4H2,(H,15,18,20)(H,16,17,19) |
| InChIKey | XWKCSBCMVPBHJY-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 91.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.13 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|